Products 1007-42-7
CAS 1007-42-7 appears in our catalog under these names: L-HISTIDINE HCL, 97%, H-His-OH·xHCl 98%, H-His-OH·xHCl, 98%, L-Histidine xhydrochloride, 97%, H-His-OH.xHCl, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 500g, 1kg, 1000g, 10g, 25g, 100g.
(2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride (CAS 1007-42-7) is a chemical compound with the molecular formula C6H10ClN3O2 and a molecular weight of 191.61 g/mol. IUPAC name: (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride. InChIKey: QZNNVYOVQUKYSC-JEDNCBNOSA-N.
| Molecular formula | C6H10ClN3O2 |
|---|---|
| Molecular weight | 191.61 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride |
| InChIKey | QZNNVYOVQUKYSC-JEDNCBNOSA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)