Products 645-35-2
CAS 645-35-2 appears in our catalog under these names: L–Hisidine monohydrocholoride, L-Histidine hydrochloride solution, L-Hisidine (monohydrocholoride), 99.76%, L-Histidine hydrochloride, L-Hisidine (monohydrocholoride), 97%. Offered by: GLPBio, Biosynth, Sigma-Aldrich, MedChemExpress, HPC Standards. Available pack sizes: 100g, 500g, 2,5g, 0,25g, 5ML, 500 g, 250 g, 100 g.
(2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride (CAS 645-35-2) is a chemical compound with the molecular formula C6H10ClN3O2 and a molecular weight of 191.61 g/mol. IUPAC name: (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride. InChIKey: QZNNVYOVQUKYSC-JEDNCBNOSA-N.
| Molecular formula | C6H10ClN3O2 |
|---|---|
| Molecular weight | 191.61 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride |
| InChIKey | QZNNVYOVQUKYSC-JEDNCBNOSA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)