CAS 100716-41-4 is the registry number for (4-Chloro-2-nitrophenyl)(2-phenylethyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-2-nitro-N-(2-phenylethyl)aniline (CAS 100716-41-4) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: 4-chloro-2-nitro-N-(2-phenylethyl)aniline. InChIKey: LFUHURIYLBVPAJ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2 |
|---|---|
| Molecular weight | 276.72 g/mol |
| IUPAC name | 4-chloro-2-nitro-N-(2-phenylethyl)aniline |
| InChIKey | LFUHURIYLBVPAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)