CAS 125038-59-7 appears in our catalog under these names: 2-Chloro-n-(4-methoxybenzyl)nicotinamide, 95%, 2–chloro–N–(4–methoxybenzyl)nicotinamide, 2-Chloro-N-(4-methoxybenzyl)nicotinamide. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g.
2-chloro-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide (CAS 125038-59-7) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: 2-chloro-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide. InChIKey: NMBHNBYSIGGVJM-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2 |
|---|---|
| Molecular weight | 276.72 g/mol |
| IUPAC name | 2-chloro-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide |
| InChIKey | NMBHNBYSIGGVJM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC(=O)C2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)