Products 338404-09-4
CAS 338404-09-4 is the registry number for 4-(2-Chlorobenzoyl)-n,n-dimethyl-1h-pyrrole-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(2-chlorobenzoyl)-N,N-dimethyl-1H-pyrrole-2-carboxamide (CAS 338404-09-4) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: 4-(2-chlorobenzoyl)-N,N-dimethyl-1H-pyrrole-2-carboxamide. InChIKey: TWASJZUTLZPEKD-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2 |
|---|---|
| Molecular weight | 276.72 g/mol |
| IUPAC name | 4-(2-chlorobenzoyl)-N,N-dimethyl-1H-pyrrole-2-carboxamide |
| InChIKey | TWASJZUTLZPEKD-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CN1)C(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)