Products 1440526-40-8

CAS 1440526-40-8 is the registry number for 4-Chloromethyl-2-phenyl-pyrimidine-5-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-(chloromethyl)-2-phenylpyrimidine-5-carboxylate (CAS 1440526-40-8) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: ethyl 4-(chloromethyl)-2-phenylpyrimidine-5-carboxylate. InChIKey: VWSUARLZRWEHPI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13ClN2O2
Molecular weight276.72 g/mol
IUPAC nameethyl 4-(chloromethyl)-2-phenylpyrimidine-5-carboxylate
InChIKeyVWSUARLZRWEHPI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C(N=C1CCl)C2=CC=CC=C2

Computed by PubChem (NCBI)