Products 100723-71-5

CAS 100723-71-5 appears in our catalog under these names: Tos–Gly–Pro–OH, Tos-Gly-Pro-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxylic acid (CAS 100723-71-5) is a chemical compound with the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. IUPAC name: (2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxylic acid. InChIKey: PKLPIXGPPLQAQK-LBPRGKRZSA-N.

Identity
Molecular formulaC14H18N2O5S
Molecular weight326.37 g/mol
IUPAC name(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxylic acid
InChIKeyPKLPIXGPPLQAQK-LBPRGKRZSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)NCC(=O)N2CCC[C@H]2C(=O)O

Computed by PubChem (NCBI)