CAS 100723-71-5 appears in our catalog under these names: Tos–Gly–Pro–OH, Tos-Gly-Pro-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 5g, 25g, 10g.
(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxylic acid (CAS 100723-71-5) is a chemical compound with the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. IUPAC name: (2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxylic acid. InChIKey: PKLPIXGPPLQAQK-LBPRGKRZSA-N.
| Molecular formula | C14H18N2O5S |
|---|---|
| Molecular weight | 326.37 g/mol |
| IUPAC name | (2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carboxylic acid |
| InChIKey | PKLPIXGPPLQAQK-LBPRGKRZSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC(=O)N2CCC[C@H]2C(=O)O |
Computed by PubChem (NCBI)