CAS 1076199-51-3 appears in our catalog under these names: 6-((Benzo[d]isoxazol-3-ylmethyl)sulfonamido)hexanoic acid, 98%, Zonisamide Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-(1,2-benzoxazol-3-ylmethylsulfonylamino)hexanoic acid (CAS 1076199-51-3) is a chemical compound with the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. IUPAC name: 6-(1,2-benzoxazol-3-ylmethylsulfonylamino)hexanoic acid. InChIKey: NBHIYPDMMAHZJT-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O5S |
|---|---|
| Molecular weight | 326.37 g/mol |
| IUPAC name | 6-(1,2-benzoxazol-3-ylmethylsulfonylamino)hexanoic acid |
| InChIKey | NBHIYPDMMAHZJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NO2)CS(=O)(=O)NCCCCCC(=O)O |
Computed by PubChem (NCBI)