CAS 393795-65-8 is the registry number for 4-{5-[(Dimethylamino)sulfonyl]-2,3-dihydro-1H-indo-1-yl}-4-oxobutanoic acid, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
4-[5-(dimethylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid (CAS 393795-65-8) is a chemical compound with the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. IUPAC name: 4-[5-(dimethylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid. InChIKey: WMNHIJYUHUMZIH-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O5S |
|---|---|
| Molecular weight | 326.37 g/mol |
| IUPAC name | 4-[5-(dimethylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
| InChIKey | WMNHIJYUHUMZIH-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC2=C(C=C1)N(CC2)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)