Products 143164-10-7
CAS 143164-10-7 is the registry number for RWJ 29009. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl)piperidin-2-one (CAS 143164-10-7) is a chemical compound with the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. IUPAC name: 1-(6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl)piperidin-2-one. InChIKey: QPFLGGHDOFTBOK-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O5S |
|---|---|
| Molecular weight | 326.37 g/mol |
| IUPAC name | 1-(6-hydroxy-5,5-dimethyl-2-nitro-6,7-dihydrothieno[3,2-b]pyran-7-yl)piperidin-2-one |
| InChIKey | QPFLGGHDOFTBOK-UHFFFAOYSA-N |
| SMILES | CC1(C(C(C2=C(O1)C=C(S2)[N+](=O)[O-])N3CCCCC3=O)O)C |
Computed by PubChem (NCBI)