Products 1007303-85-6
CAS 1007303-85-6 is the registry number for 5-(1H-Pyrazol-1-ylmethyl)-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(pyrazol-1-ylmethyl)-1,2-oxazole-3-carboxylic acid (CAS 1007303-85-6) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 5-(pyrazol-1-ylmethyl)-1,2-oxazole-3-carboxylic acid. InChIKey: CBGUJZIFSIIRNM-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 5-(pyrazol-1-ylmethyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | CBGUJZIFSIIRNM-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CC2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)