CAS 1007458-87-8 appears in our catalog under these names: 2,3,5,6-Tetrabromo-p-xylene-d6, >95% (HPLC), 1,2,4,5-Tetrabromo-3,6-dimethylbenzene-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 2.5 mg.
1,2,4,5-tetrabromo-3,6-bis(trideuteriomethyl)benzene (CAS 1007458-87-8) is a chemical compound with the molecular formula C8H6Br4 and a molecular weight of 427.79 g/mol. IUPAC name: 1,2,4,5-tetrabromo-3,6-bis(trideuteriomethyl)benzene. InChIKey: RXKOKVQKECXYOT-WFGJKAKNSA-N.
| Molecular formula | C8H6Br4 |
|---|---|
| Molecular weight | 427.79 g/mol |
| IUPAC name | 1,2,4,5-tetrabromo-3,6-bis(trideuteriomethyl)benzene |
| InChIKey | RXKOKVQKECXYOT-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=C(C(=C1Br)Br)C([2H])([2H])[2H])Br)Br |
Computed by PubChem (NCBI)