CAS 36323-28-1 appears in our catalog under these names: α,α,α',α'–Tetrabromo–m–xylene, alpha,alpha,alpha',alpha'-Tetrabromo-m-xylene, >96.0%(GC), 1,3-Bis(dibromomethyl)benzene, ≥96%(GC), ≥96%(GC). Offered by: GLPBio, TCI, Chemat. Available pack sizes: 5g, 10g, 25g.
1,3-bis(dibromomethyl)benzene (CAS 36323-28-1) is a chemical compound with the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. IUPAC name: 1,3-bis(dibromomethyl)benzene. InChIKey: ZMCUKNMLHBAGMS-UHFFFAOYSA-N.
| Molecular formula | C8H6Br4 |
|---|---|
| Molecular weight | 421.75 g/mol |
| IUPAC name | 1,3-bis(dibromomethyl)benzene |
| InChIKey | ZMCUKNMLHBAGMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(Br)Br)C(Br)Br |
Computed by PubChem (NCBI)