CAS 52964-29-1 is the registry number for 1,4–Dibromo–2,3–bis(bromomethyl)benzene. Offered by: GLPBio. Available pack sizes: 100mg.
1,4-dibromo-2,3-bis(bromomethyl)benzene (CAS 52964-29-1) is a chemical compound with the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. IUPAC name: 1,4-dibromo-2,3-bis(bromomethyl)benzene. InChIKey: YCKCSLFYFZNQDL-UHFFFAOYSA-N.
| Molecular formula | C8H6Br4 |
|---|---|
| Molecular weight | 421.75 g/mol |
| IUPAC name | 1,4-dibromo-2,3-bis(bromomethyl)benzene |
| InChIKey | YCKCSLFYFZNQDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)CBr)CBr)Br |
Computed by PubChem (NCBI)