CAS 100750-39-8 appears in our catalog under these names: N-Acetyl-3-acetoxy-5-phenylpyrrole, APPA. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 10 mg, 50 mg, 25 mg.
(1-acetyl-5-phenylpyrrol-3-yl) acetate (CAS 100750-39-8) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: (1-acetyl-5-phenylpyrrol-3-yl) acetate. InChIKey: WKSITCBIIIHVSF-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | (1-acetyl-5-phenylpyrrol-3-yl) acetate |
| InChIKey | WKSITCBIIIHVSF-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=C(C=C1C2=CC=CC=C2)OC(=O)C |
Computed by PubChem (NCBI)