Products 1007541-84-5
CAS 1007541-84-5 appears in our catalog under these names: 3-(2-Chlorophenyl)-1H-pyrazole-4-carboxylic acid, 5-(2-Chlorophenyl)-1H-pyrazole-4-carboxylic acid, 95%, 95%, 5-(2-Chlorophenyl)-1H-pyrazole-4-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
5-(2-chlorophenyl)-1H-pyrazole-4-carboxylic acid (CAS 1007541-84-5) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 5-(2-chlorophenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: HXXALKIHVJHCQL-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-1H-pyrazole-4-carboxylic acid |
| InChIKey | HXXALKIHVJHCQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C=NN2)C(=O)O)Cl |
Computed by PubChem (NCBI)