CAS 1007579-67-0 appears in our catalog under these names: 4-Iodo-2-(trifluoromethyl)benzaldehyde, 95%, 4-Iodo-2-(trifluoromethyl)benzaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-iodo-2-(trifluoromethyl)benzaldehyde (CAS 1007579-67-0) is a chemical compound with the molecular formula C8H4F3IO and a molecular weight of 300.02 g/mol. IUPAC name: 4-iodo-2-(trifluoromethyl)benzaldehyde. InChIKey: KKFCXRKONPDJPV-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO |
|---|---|
| Molecular weight | 300.02 g/mol |
| IUPAC name | 4-iodo-2-(trifluoromethyl)benzaldehyde |
| InChIKey | KKFCXRKONPDJPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C(F)(F)F)C=O |
Computed by PubChem (NCBI)