CAS 372120-53-1 is the registry number for 3-Iodo-4-(trifluoromethyl)benzaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-iodo-4-(trifluoromethyl)benzaldehyde (CAS 372120-53-1) is a chemical compound with the molecular formula C8H4F3IO and a molecular weight of 300.02 g/mol. IUPAC name: 3-iodo-4-(trifluoromethyl)benzaldehyde. InChIKey: REEASCRMMSWHJT-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO |
|---|---|
| Molecular weight | 300.02 g/mol |
| IUPAC name | 3-iodo-4-(trifluoromethyl)benzaldehyde |
| InChIKey | REEASCRMMSWHJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)I)C(F)(F)F |
Computed by PubChem (NCBI)