CAS 875446-23-4 is the registry number for 2-Iodo-5-(trifluoromethyl)benzaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 5g.
2-iodo-5-(trifluoromethyl)benzaldehyde (CAS 875446-23-4) is a chemical compound with the molecular formula C8H4F3IO and a molecular weight of 300.02 g/mol. IUPAC name: 2-iodo-5-(trifluoromethyl)benzaldehyde. InChIKey: CRKFYUIXVLHGLN-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO |
|---|---|
| Molecular weight | 300.02 g/mol |
| IUPAC name | 2-iodo-5-(trifluoromethyl)benzaldehyde |
| InChIKey | CRKFYUIXVLHGLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C=O)I |
Computed by PubChem (NCBI)