CAS 1261777-98-3 appears in our catalog under these names: 4-Iodo-3-(trifluoromethyl)benzaldehyde, 98%, 4-Iodo-3-(trifluoromethyl)benzaldehyde, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 250mg.
4-iodo-3-(trifluoromethyl)benzaldehyde (CAS 1261777-98-3) is a chemical compound with the molecular formula C8H4F3IO and a molecular weight of 300.02 g/mol. IUPAC name: 4-iodo-3-(trifluoromethyl)benzaldehyde. InChIKey: ZUWGFQDHUQCKFV-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO |
|---|---|
| Molecular weight | 300.02 g/mol |
| IUPAC name | 4-iodo-3-(trifluoromethyl)benzaldehyde |
| InChIKey | ZUWGFQDHUQCKFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)C(F)(F)F)I |
Computed by PubChem (NCBI)