CAS 1007881-64-2 is the registry number for (1R,3S)-3-((Methoxycarbonyl)amino)cyclopentane-1-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
Cis-(1R,3S)-3-(methoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 1007881-64-2) is a chemical compound with the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. IUPAC name: cis-(1R,3S)-3-(methoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: QWVQNVGWAHLTMO-RITPCOANSA-N.
| Molecular formula | C8H13NO4 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | cis-(1R,3S)-3-(methoxycarbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | QWVQNVGWAHLTMO-RITPCOANSA-N |
| SMILES | COC(=O)N[C@H]1CC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)