Products 1007881-64-2

CAS 1007881-64-2 is the registry number for (1R,3S)-3-((Methoxycarbonyl)amino)cyclopentane-1-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Cis-(1R,3S)-3-(methoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 1007881-64-2) is a chemical compound with the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. IUPAC name: cis-(1R,3S)-3-(methoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: QWVQNVGWAHLTMO-RITPCOANSA-N.

Identity
Molecular formulaC8H13NO4
Molecular weight187.19 g/mol
IUPAC namecis-(1R,3S)-3-(methoxycarbonylamino)cyclopentane-1-carboxylic acid
InChIKeyQWVQNVGWAHLTMO-RITPCOANSA-N
SMILESCOC(=O)N[C@H]1CC[C@H](C1)C(=O)O

Computed by PubChem (NCBI)