Products 1609396-50-0
CAS 1609396-50-0 appears in our catalog under these names: 5-[(Dimethylamino)methyl]-2-furoic acid hydrate, 95%, 5-((Dimethylamino)methyl)furan-2-carboxylic acid hydrate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-[(dimethylamino)methyl]furan-2-carboxylic acid;hydrate (CAS 1609396-50-0) is a chemical compound with the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. IUPAC name: 5-[(dimethylamino)methyl]furan-2-carboxylic acid;hydrate. InChIKey: KEKCFBACMRKSMX-UHFFFAOYSA-N.
| Molecular formula | C8H13NO4 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 5-[(dimethylamino)methyl]furan-2-carboxylic acid;hydrate |
| InChIKey | KEKCFBACMRKSMX-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC=C(O1)C(=O)O.O |
Computed by PubChem (NCBI)