Products 2155873-13-3
CAS 2155873-13-3 appears in our catalog under these names: 2-[(2Z)-3-methoxyprop-2-enamido]-2-methylpropanoic acid, 95%, (Z)-2-(3-Methoxyacrylamido)-2-methylpropanoic acid hydrochloride, 98%, 2-((2Z)-3-Methoxyprop-2-enamido)-2-methylpropanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[[(Z)-3-methoxyprop-2-enoyl]amino]-2-methylpropanoic acid (CAS 2155873-13-3) is a chemical compound with the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. IUPAC name: 2-[[(Z)-3-methoxyprop-2-enoyl]amino]-2-methylpropanoic acid. InChIKey: FTLZCGFAHOHDET-PLNGDYQASA-N.
| Molecular formula | C8H13NO4 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-[[(Z)-3-methoxyprop-2-enoyl]amino]-2-methylpropanoic acid |
| InChIKey | FTLZCGFAHOHDET-PLNGDYQASA-N |
| SMILES | CC(C)(C(=O)O)NC(=O)/C=C\OC |
Computed by PubChem (NCBI)