CAS 102389-88-8 is the registry number for Dimethyl trans-(+/-)-pyrrolidine-3,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Dimethyl (3S,4S)-pyrrolidine-3,4-dicarboxylate (CAS 102389-88-8) is a chemical compound with the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. IUPAC name: dimethyl (3S,4S)-pyrrolidine-3,4-dicarboxylate. InChIKey: DEONENFBMPLKOR-PHDIDXHHSA-N.
| Molecular formula | C8H13NO4 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | dimethyl (3S,4S)-pyrrolidine-3,4-dicarboxylate |
| InChIKey | DEONENFBMPLKOR-PHDIDXHHSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)