Products 2172543-97-2

CAS 2172543-97-2 is the registry number for Methyl 4-amino-1-benzylpyrrolidine-3-carboxylate dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-1-benzylpyrrolidine-3-carboxylate;dihydrochloride (CAS 2172543-97-2) is a chemical compound with the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.21 g/mol. IUPAC name: methyl 4-amino-1-benzylpyrrolidine-3-carboxylate;dihydrochloride. InChIKey: GVQVNDUVGMNGPW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20Cl2N2O2
Molecular weight307.21 g/mol
IUPAC namemethyl 4-amino-1-benzylpyrrolidine-3-carboxylate;dihydrochloride
InChIKeyGVQVNDUVGMNGPW-UHFFFAOYSA-N
SMILESCOC(=O)C1CN(CC1N)CC2=CC=CC=C2.Cl.Cl

Computed by PubChem (NCBI)