Products 1008112-06-8

CAS 1008112-06-8 is the registry number for Methyl 3-nitro-1H-pyrazole-5-carboxylate 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Methyl 5-nitro-1H-pyrazole-3-carboxylate (CAS 1008112-06-8) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: methyl 5-nitro-1H-pyrazole-3-carboxylate. InChIKey: OTINMTPELZSAPX-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5N3O4
Molecular weight171.11 g/mol
IUPAC namemethyl 5-nitro-1H-pyrazole-3-carboxylate
InChIKeyOTINMTPELZSAPX-UHFFFAOYSA-N
SMILESCOC(=O)C1=NNC(=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)