CAS 1008112-06-8 is the registry number for Methyl 3-nitro-1H-pyrazole-5-carboxylate 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.
Methyl 5-nitro-1H-pyrazole-3-carboxylate (CAS 1008112-06-8) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: methyl 5-nitro-1H-pyrazole-3-carboxylate. InChIKey: OTINMTPELZSAPX-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | methyl 5-nitro-1H-pyrazole-3-carboxylate |
| InChIKey | OTINMTPELZSAPX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NNC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)