CAS 7164-43-4 appears in our catalog under these names: 5-Aminoorotic acid, 98%, 5–Aminoorotic Acid, 5-Aminoorotic acid, 5-Aminoorotic Acid, >97.0%(N)(T), 5-Amino-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 100g, 5g, 1g, 500g, 1kg, 0,5kg, 2kg.
5-amino-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 7164-43-4) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 5-amino-2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: HWCXJKLFOSBVLH-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 5-amino-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChIKey | HWCXJKLFOSBVLH-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)C(=O)O)N |
Computed by PubChem (NCBI)