CAS 680881-02-1 is the registry number for 2-Methyl-5-nitro-pyrimidine-4,6-diol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-methyl-5-nitro-1H-pyrimidine-4,6-dione (CAS 680881-02-1) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 2-methyl-5-nitro-1H-pyrimidine-4,6-dione. InChIKey: ZZNISJSMHFZAJF-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 2-methyl-5-nitro-1H-pyrimidine-4,6-dione |
| InChIKey | ZZNISJSMHFZAJF-UHFFFAOYSA-N |
| SMILES | CC1=NC(=O)C(C(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)