CAS 5334-38-3 appears in our catalog under these names: 5-Methyl-4-nitro-1h-pyrazole-3-carboxylic acid, 97%, 3-Methyl-4-nitro-1h-pyrazole-5-carboxylic acid, 97%, 3-Methyl-4-nitro-1H-pyrazole-5-carboxylic acid 95%, 3-Methyl-4-nitro-1H-pyrazole-5-carboxylic acid, 95%, 95%, 3-Methyl-4-nitro-1H-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg, 500mg, 2.5g.
5-methyl-4-nitro-1H-pyrazole-3-carboxylic acid (CAS 5334-38-3) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 5-methyl-4-nitro-1H-pyrazole-3-carboxylic acid. InChIKey: RFGSRUNVFVKCGD-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 5-methyl-4-nitro-1H-pyrazole-3-carboxylic acid |
| InChIKey | RFGSRUNVFVKCGD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)