CAS 10082-93-6 appears in our catalog under these names: (9H-Purin-6-ylamino)-acetic acid, 2-((9H-Purin-6-yl)amino)acetic acid, 97%, (9H-Purin-6-ylamino)acetic Acid (may contain up to 20% of inorganics), >95% (HPLC). Offered by: Biosynth, AmBeed, TRC. Available pack sizes: 0,5g, 50mg, 5g, 10g, 10mg, 25mg.
2-(7H-purin-6-ylamino)acetic acid (CAS 10082-93-6) is a chemical compound with the molecular formula C7H7N5O2 and a molecular weight of 193.16 g/mol. IUPAC name: 2-(7H-purin-6-ylamino)acetic acid. InChIKey: QQDOCXUDXYMTRL-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O2 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-(7H-purin-6-ylamino)acetic acid |
| InChIKey | QQDOCXUDXYMTRL-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC=N2)NCC(=O)O |
Computed by PubChem (NCBI)