CAS 20128-29-4 appears in our catalog under these names: 6-Amino-9H-purine-9-acetic Acid, 2-(6-Amino-9H-purin-9-yl)acetic acid, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-(6-aminopurin-9-yl)acetic acid (CAS 20128-29-4) is a chemical compound with the molecular formula C7H7N5O2 and a molecular weight of 193.16 g/mol. IUPAC name: 2-(6-aminopurin-9-yl)acetic acid. InChIKey: HHVNWGFYTKKIJO-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O2 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-(6-aminopurin-9-yl)acetic acid |
| InChIKey | HHVNWGFYTKKIJO-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)CC(=O)O)N |
Computed by PubChem (NCBI)