CAS 1337881-83-0 is the registry number for 2,4-Diamino-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-diamino-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid (CAS 1337881-83-0) is a chemical compound with the molecular formula C7H7N5O2 and a molecular weight of 193.16 g/mol. IUPAC name: 2,4-diamino-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: RJNYOGGIYJLHFC-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O2 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2,4-diamino-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | RJNYOGGIYJLHFC-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=NC(=NC(=C21)N)N)C(=O)O |
Computed by PubChem (NCBI)