CAS 694514-39-1 appears in our catalog under these names: Folic Acid Impurity 2, 2-Amino-7-(hydroxymethyl)pteridin-4(3H)-one, 98%, 2-Amino-7-(hydroxymethyl)-4(3H)-pteridinone. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg.
2-amino-7-(hydroxymethyl)-3H-pteridin-4-one (CAS 694514-39-1) is a chemical compound with the molecular formula C7H7N5O2 and a molecular weight of 193.16 g/mol. IUPAC name: 2-amino-7-(hydroxymethyl)-3H-pteridin-4-one. InChIKey: SBQIXXSMVJATAT-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O2 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-amino-7-(hydroxymethyl)-3H-pteridin-4-one |
| InChIKey | SBQIXXSMVJATAT-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=N1)C(=O)NC(=N2)N)CO |
Computed by PubChem (NCBI)