CAS 100823-17-4 appears in our catalog under these names: 4-Chloro-2,6-diisopropylaniline 95%, 4-CHLORO-2,6-DIISOPROPYLANILINE, 97%, 4-Chloro-2,6-diisopropylaniline, 95%, 95%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-chloro-2,6-di(propan-2-yl)aniline (CAS 100823-17-4) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 4-chloro-2,6-di(propan-2-yl)aniline. InChIKey: KVCOLLORJVMSTQ-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 4-chloro-2,6-di(propan-2-yl)aniline |
| InChIKey | KVCOLLORJVMSTQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)Cl |
Computed by PubChem (NCBI)