Products 1008283-55-3
CAS 1008283-55-3 is the registry number for 1-(Adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (CAS 1008283-55-3) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: BRKBIWGWCNIXKI-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | BRKBIWGWCNIXKI-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)N4CC(CC4C(=O)O)O |
Computed by PubChem (NCBI)