Products 1807938-86-8
CAS 1807938-86-8 is the registry number for (2S,4R)-1-(Adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S,4R)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (CAS 1807938-86-8) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (2S,4R)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: BRKBIWGWCNIXKI-OPLYUGDSSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (2S,4R)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | BRKBIWGWCNIXKI-OPLYUGDSSA-N |
| SMILES | C1[C@H](CN([C@@H]1C(=O)O)C(=O)C23CC4CC(C2)CC(C4)C3)O |
Computed by PubChem (NCBI)