CAS 100856-85-7 appears in our catalog under these names: 4-hydroxy-2-mercapto-5-methyl-7H-pyrano(2,3-d)pyrimidin-7-one, Moxonidine Impurity 6 . Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-methyl-2-sulfanylidene-1H-pyrano[2,3-d]pyrimidine-4,7-dione (CAS 100856-85-7) is a chemical compound with the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. IUPAC name: 5-methyl-2-sulfanylidene-1H-pyrano[2,3-d]pyrimidine-4,7-dione. InChIKey: KSKVORJZAARSNB-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 5-methyl-2-sulfanylidene-1H-pyrano[2,3-d]pyrimidine-4,7-dione |
| InChIKey | KSKVORJZAARSNB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C(=O)NC(=S)N2 |
Computed by PubChem (NCBI)