CAS 1008769-87-6 appears in our catalog under these names: 4-Bromo-3-(trifluoromethoxy)benzoic acid, 95%, 4-bromo-3-(trifluoromethoxy)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
4-bromo-3-(trifluoromethoxy)benzoic acid (CAS 1008769-87-6) is a chemical compound with the molecular formula C8H4BrF3O3 and a molecular weight of 285.01 g/mol. IUPAC name: 4-bromo-3-(trifluoromethoxy)benzoic acid. InChIKey: HTDQBKCOVJMGAF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O3 |
|---|---|
| Molecular weight | 285.01 g/mol |
| IUPAC name | 4-bromo-3-(trifluoromethoxy)benzoic acid |
| InChIKey | HTDQBKCOVJMGAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)OC(F)(F)F)Br |
Computed by PubChem (NCBI)