Products 85373-96-2
CAS 85373-96-2 appears in our catalog under these names: 3-Bromo-4-(trifluoromethoxy)benzoic acid, 98%, 3–Bromo–4–(trifluoromethoxy)benzoic acid, 3-Bromo-4-(trifluoromethoxy)benzoic acid 95%, 3-Bromo-4-(trifluoromethoxy)benzoic acid, 97%, 97%, 3-Bromo-4-(trifluoromethoxy)benzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g.
3-bromo-4-(trifluoromethoxy)benzoic acid (CAS 85373-96-2) is a chemical compound with the molecular formula C8H4BrF3O3 and a molecular weight of 285.01 g/mol. IUPAC name: 3-bromo-4-(trifluoromethoxy)benzoic acid. InChIKey: FZZJKGGHTKIIIJ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O3 |
|---|---|
| Molecular weight | 285.01 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethoxy)benzoic acid |
| InChIKey | FZZJKGGHTKIIIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)OC(F)(F)F |
Computed by PubChem (NCBI)