Products 1138331-74-4
CAS 1138331-74-4 appears in our catalog under these names: 2-Bromo-4-(trifluoromethoxy)benzoic acid, 2-Bromo-4-(trifluoromethoxy)benzoic acid, 95%, 2-Bromo-4-(trifluoromethoxy)benzonic acid 97%, 2-Bromo-4-(trifluoromethoxy)benzoic acid, 96%, 2-Bromo-4-(trifluoromethoxy)benzoic acid, 97%, 97%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 250mg, 100mg, 500mg, 2.5g.
2-bromo-4-(trifluoromethoxy)benzoic acid (CAS 1138331-74-4) is a chemical compound with the molecular formula C8H4BrF3O3 and a molecular weight of 285.01 g/mol. IUPAC name: 2-bromo-4-(trifluoromethoxy)benzoic acid. InChIKey: IICZHYLOCHKTPT-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O3 |
|---|---|
| Molecular weight | 285.01 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethoxy)benzoic acid |
| InChIKey | IICZHYLOCHKTPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)