Products 509142-48-7

CAS 509142-48-7 appears in our catalog under these names: 4-Bromo-2-(trifluoromethoxy)benzoic acid 95%, 4-Bromo-2-(trifluoromethoxy)benzoic acid, >95%, >95%, 4-Bromo-2-(trifluoromethoxy)benzoic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 10g, 500g.

Structural formula: {0} (CAS {1})

4-bromo-2-(trifluoromethoxy)benzoic acid (CAS 509142-48-7) is a chemical compound with the molecular formula C8H4BrF3O3 and a molecular weight of 285.01 g/mol. IUPAC name: 4-bromo-2-(trifluoromethoxy)benzoic acid. InChIKey: LMFGPGVCUFRLQC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4BrF3O3
Molecular weight285.01 g/mol
IUPAC name4-bromo-2-(trifluoromethoxy)benzoic acid
InChIKeyLMFGPGVCUFRLQC-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)OC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)