CAS 100880-61-3 appears in our catalog under these names: 4-N-Phthaloylglyaminomethyl aniline, 98%, 2-(4-Aminobenzyl)isoindoline-1,3-dione, 98%, 4-N-Phthaloylglyaminomethyl aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 25g, 2,5g.
2-[(4-aminophenyl)methyl]isoindole-1,3-dione (CAS 100880-61-3) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 2-[(4-aminophenyl)methyl]isoindole-1,3-dione. InChIKey: FPSRUFWSIDRGBT-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-[(4-aminophenyl)methyl]isoindole-1,3-dione |
| InChIKey | FPSRUFWSIDRGBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)