CAS 100905-33-7 is the registry number for Ethyl 4,5-dimethoxy-2-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
Ethyl 4,5-dimethoxy-2-nitrobenzoate (CAS 100905-33-7) is a chemical compound with the molecular formula C11H13NO6 and a molecular weight of 255.22 g/mol. IUPAC name: ethyl 4,5-dimethoxy-2-nitrobenzoate. InChIKey: VNPCXITWHOOQAJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO6 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | ethyl 4,5-dimethoxy-2-nitrobenzoate |
| InChIKey | VNPCXITWHOOQAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1[N+](=O)[O-])OC)OC |
Computed by PubChem (NCBI)