Products 1171393-07-9

CAS 1171393-07-9 is the registry number for 3-(2,3-Dimethoxy-5-nitrophenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(2,3-dimethoxy-5-nitrophenyl)propanoic acid (CAS 1171393-07-9) is a chemical compound with the molecular formula C11H13NO6 and a molecular weight of 255.22 g/mol. IUPAC name: 3-(2,3-dimethoxy-5-nitrophenyl)propanoic acid. InChIKey: XMEKYUKXPIMEOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO6
Molecular weight255.22 g/mol
IUPAC name3-(2,3-dimethoxy-5-nitrophenyl)propanoic acid
InChIKeyXMEKYUKXPIMEOJ-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)CCC(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)