CAS 1171393-07-9 is the registry number for 3-(2,3-Dimethoxy-5-nitrophenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2,3-dimethoxy-5-nitrophenyl)propanoic acid (CAS 1171393-07-9) is a chemical compound with the molecular formula C11H13NO6 and a molecular weight of 255.22 g/mol. IUPAC name: 3-(2,3-dimethoxy-5-nitrophenyl)propanoic acid. InChIKey: XMEKYUKXPIMEOJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO6 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 3-(2,3-dimethoxy-5-nitrophenyl)propanoic acid |
| InChIKey | XMEKYUKXPIMEOJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)CCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)