CAS 54173-39-6 is the registry number for 3,4,5-Trimethoxy-2-nitro acetophenone. Offered by: TRC. Available pack sizes: 5g.
1-(3,4,5-trimethoxy-2-nitrophenyl)ethanone (CAS 54173-39-6) is a chemical compound with the molecular formula C11H13NO6 and a molecular weight of 255.22 g/mol. IUPAC name: 1-(3,4,5-trimethoxy-2-nitrophenyl)ethanone. InChIKey: ZHVMCSUVRFDCIY-UHFFFAOYSA-N.
| Molecular formula | C11H13NO6 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 1-(3,4,5-trimethoxy-2-nitrophenyl)ethanone |
| InChIKey | ZHVMCSUVRFDCIY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1[N+](=O)[O-])OC)OC)OC |
Computed by PubChem (NCBI)