Products 1396963-14-6

CAS 1396963-14-6 is the registry number for N-(2-Methyl-3-furoyl)glutamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(2-methylfuran-3-carbonyl)amino]pentanedioic acid (CAS 1396963-14-6) is a chemical compound with the molecular formula C11H13NO6 and a molecular weight of 255.22 g/mol. IUPAC name: 2-[(2-methylfuran-3-carbonyl)amino]pentanedioic acid. InChIKey: MZLVQXFNQJPFNH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO6
Molecular weight255.22 g/mol
IUPAC name2-[(2-methylfuran-3-carbonyl)amino]pentanedioic acid
InChIKeyMZLVQXFNQJPFNH-UHFFFAOYSA-N
SMILESCC1=C(C=CO1)C(=O)NC(CCC(=O)O)C(=O)O

Computed by PubChem (NCBI)