CAS 1009244-02-3 appears in our catalog under these names: 1-[(3,4-Dimethylphenyl)sulfonyl]-4-hydroxypyrrolidine-2-carboxylic acid, 95%, 1-(3,4-Dimethylbenzenesulfonyl)-4-hydroxypyrrolidine-2-carboxylic acid, 98%, 1-(3,4-Dimethylbenzenesulfonyl)-4-hydroxypyrrolidine-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylic acid (CAS 1009244-02-3) is a chemical compound with the molecular formula C13H17NO5S and a molecular weight of 299.34 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: HEYLUDCGZDIEQI-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5S |
|---|---|
| Molecular weight | 299.34 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | HEYLUDCGZDIEQI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N2CC(CC2C(=O)O)O)C |
Computed by PubChem (NCBI)