Products 168890-58-2

CAS 168890-58-2 is the registry number for 2-Methoxy-5-(piperidin-1-ylsulfonyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-methoxy-5-piperidin-1-ylsulfonylbenzoic acid (CAS 168890-58-2) is a chemical compound with the molecular formula C13H17NO5S and a molecular weight of 299.34 g/mol. IUPAC name: 2-methoxy-5-piperidin-1-ylsulfonylbenzoic acid. InChIKey: WUGNTIANQVMIOO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO5S
Molecular weight299.34 g/mol
IUPAC name2-methoxy-5-piperidin-1-ylsulfonylbenzoic acid
InChIKeyWUGNTIANQVMIOO-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)S(=O)(=O)N2CCCCC2)C(=O)O

Computed by PubChem (NCBI)