CAS 328038-27-3 appears in our catalog under these names: 4-(2,6-Dimethyl-morpholine-4-sulfonyl)-benzoic acid, 95%, 4-((2,6-Dimethylmorpholin-4-yl)sulfonyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoic acid (CAS 328038-27-3) is a chemical compound with the molecular formula C13H17NO5S and a molecular weight of 299.34 g/mol. IUPAC name: 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoic acid. InChIKey: KUPQRFNEGVYXAT-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5S |
|---|---|
| Molecular weight | 299.34 g/mol |
| IUPAC name | 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoic acid |
| InChIKey | KUPQRFNEGVYXAT-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)S(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)