CAS 312532-21-1 appears in our catalog under these names: 3-(2,6-Dimethyl-morpholine-4-sulfonyl)-benzoic acid, 95%, 3-((2,6-Dimethylmorpholino)sulfonyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoic acid (CAS 312532-21-1) is a chemical compound with the molecular formula C13H17NO5S and a molecular weight of 299.34 g/mol. IUPAC name: 3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoic acid. InChIKey: SHIDBEVAWHWDFA-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5S |
|---|---|
| Molecular weight | 299.34 g/mol |
| IUPAC name | 3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoic acid |
| InChIKey | SHIDBEVAWHWDFA-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)